Thủ Thuật Hướng dẫn Cho những phương trình phản ứng hóa học theo như đúng tỉ lệ mol Mới Nhất

Pro đang tìm kiếm từ khóa Cho những phương trình phản ứng hóa học theo như đúng tỉ lệ mol được Cập Nhật vào lúc : 2022-08-07 19:40:20 . Với phương châm chia sẻ Kinh Nghiệm về trong nội dung bài viết một cách Chi Tiết 2022. Nếu sau khi đọc Post vẫn ko hiểu thì hoàn toàn có thể lại phản hồi ở cuối bài để Ad lý giải và hướng dẫn lại nha.

Cho những phương trình hóa học sau xẩy ra theo như đúng tỉ lệ mol: X + 4NaOH Y + Z + T + 2NaCl + H2O. Y + 2AgNO3 +3NH3 + H2O?

Cho những phương trình hóa học sau xẩy ra theo như đúng tỉ lệ mol:
X + 4NaOH

Y + Z + T + 2NaCl + H2O.
Y + 2AgNO3 +3NH3 + H2O → C2H4NO4Na +2Ag + 2NH4NO3.
Z+ HCl→C3H6O3 + NaCl.
T+ ½.O2C2H4O2.
BiếtX không phân nhánh. Công thức cấu trúc của X là

A. CH3CH2COOCH(Cl)COOC(Cl)=CH2.

Nội dung chính

    Cho những phương trình hóa học sau xẩy ra theo như đúng tỉ lệ mol: X + 4NaOH Y + Z + T + 2NaCl + H2O. Y + 2AgNO3 +3NH3 + H2O? Câu hỏi tiên tiến và phát triển nhất

B. CH3CH(Cl)COOCH2COOC(Cl)=CH2.

C. CH3CH(Cl)COOCH(Cl)COOC2H3.

D. HOCH2COOCH(Cl)COOCH(Cl)CH3.

Câu hỏi tiên tiến và phát triển nhất

Xem thêm »

    Hòa tan hoàn toàn 21,5 gam hỗn hợp X gồm Al, Zn, FeO, Cu(NO3)2 cần dùng hết 430 ml dung dịch H2SO4 1M, thu được 0,19 mol hỗn hợp khí Y gồm hai khí không màu, có một khí hóa nâu ngoài không khí, có tỉ khối hơi so với H2 bằng 5,421; dung dịch Z chỉ chứa những muối sunfat trung hòa. Cô cạn dung dịch Z thu được 56,9 gam muối khan. Phần trăm khối lượng của Al trong hỗn hợp X là

    Hỗn hợp E gồm axit cacboxylic X (no, hai chức, mạch hở), hai ancol (no, đơn chức, mạch hở) và este Y hai chức tạo bởi X với hai ancol đó. Đốt cháy a gam E, thu được 13,64 gam CO2 và 4,68 gam H2O. Mặt khác, đun nóng a gam E với 200 ml dung dịch NaOH 1M. Để trung hòa NaOH dư cần 30 ml dung dịch H2SO4 1M, thu được dung dịch F. Cô cạn F, thu được m gam muối khan và 2,12 gam hỗn hợp T gồm hai ancol. Cho T tác dụng với Na dư, thu được 0,448 lít khí H2 (đktc). Các phản ứng xẩy ra hoàn toàn. Giá trị của m là

Xem thêm »

Cho những phương trình phản ứng hóa học sau (theo như đúng tỉ lệ mol, những phản ứng đều ở Đk và xúc tác thích hợp): (1) X + 2NaOH → X1 + X2 + H2O (2) X2 + CuO → X3 + Cu + H2O (3) X3 + 4AgNO3 + 6NH3 + H2O → (NH4)2CO3 + 4Ag + NH4NO3 (4) X1 + 2NaOH → X4 + 2Na2CO3 (5) 2X4 → X5 + 3H2

Phát biểu nào sau này sai?

A. X có 8 nguyên tử H trong phân tử.

B. X2 rất độc không được sử dụng để pha vào đồ uống.

C. X1 tan trong nước tốt hơn so với X.

D. X5 có phản ứng tạo kết tủa với AgNO3/NH3.

Chọn A.

    (1) HOOCCH2COOCH3 (X) + 2NaOH → CH2(COONa)2 + CH3OH + H2O

    (2) CH3OH (X2) + CuO → HCHO (X3) + Cu + H2O

    (3) HCHO (X3) + 4AgNO3 + 6NH3 + H2O → (NH4)2CO3 + 4Ag + NH4NO3

    (4) CH2(COONa)2 (X1) + 2NaOH → CH4 (X4) + 2Na2CO3

    (5) 2CH4 (X4) → C2H2 (X5) + 3H2

A. Sai, X có 6 nguyên tử H trong phân tử

Chọn B.

(1) HOOCCH2COOCH3 (X) + 2NaOH → CH2(COONa)2 + CH3OH + H2O

(2) CH3OH (X2) + CuO → HCHO (X3) + Cu + H2O

(3) HCHO (X3) + 4AgNO3 + 6NH3 + H2O → (NH4)2CO3 + 4Ag + NH4NO3

(4) CH2(COONa)2 (X1) + 2NaOH → CH4 (X4) + 2Na2CO3

(5) 2CH4 (X4) → C2H2 (X5) + 3H2

B. Sai, X có 6 nguyên tử H trong phân tử

Reply
0
0
Chia sẻ

4557

Video Cho những phương trình phản ứng hóa học theo như đúng tỉ lệ mol ?

Bạn vừa Read tài liệu Với Một số hướng dẫn một cách rõ ràng hơn về Review Cho những phương trình phản ứng hóa học theo như đúng tỉ lệ mol tiên tiến và phát triển nhất

Share Link Down Cho những phương trình phản ứng hóa học theo như đúng tỉ lệ mol miễn phí

Heros đang tìm một số trong những ShareLink Tải Cho những phương trình phản ứng hóa học theo như đúng tỉ lệ mol miễn phí.

Thảo Luận vướng mắc về Cho những phương trình phản ứng hóa học theo như đúng tỉ lệ mol

Nếu sau khi đọc nội dung bài viết Cho những phương trình phản ứng hóa học theo như đúng tỉ lệ mol vẫn chưa hiểu thì hoàn toàn có thể lại phản hồi ở cuối bài để Mình lý giải và hướng dẫn lại nha
#Cho #những #phương #trình #phản #ứng #hóa #học #theo #đúng #tỉ #lệ #mol